![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Chemical Brothers.htm | 2007-04-11 16:03 | 21K | |
| Chemical Brothers_files/ | 2007-04-11 16:03 | - | |
| Daft Punk.htm | 2007-04-11 16:03 | 18K | |
| Daft Punk_files/ | 2007-04-11 16:03 | - | |
| Future Sound Of London.htm | 2007-04-11 16:03 | 9.9K | |
| Future Sound Of London_files/ | 2007-04-11 16:03 | - | |
| Oasis.htm | 2007-04-11 16:03 | 33K | |
| Oasis_files/ | 2007-04-11 16:03 | - | |
| Orbital.htm | 2007-04-11 16:03 | 34K | |
| Orbital_files/ | 2007-04-11 16:03 | - | |
| Underworld.htm | 2007-04-11 16:03 | 12K | |
| Underworld_files/ | 2007-04-11 16:03 | - | |